C8H12N4O3 — CID 136973957
methyl 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]propanoate (PubChem CID 136973957) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is methyl 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]propanoate.
| Compound Name | methyl 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 136973957 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | methyl 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]propanoate |
| SMILES | COC(=O)C(C)Nc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C8H12N4O3/c1-4(8(14)15-2)12-6-5(9)7(13)11-3-10-6/h3-4H,9H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | NGGGVUZTALQHSF-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |