C8H14N4O3 — CID 136713917
5-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one (PubChem CID 136713917) has the molecular formula C8H14N4O3 and a molecular weight of 214.23 g/mol. Its IUPAC name is 5-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136713917 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 5-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one |
| SMILES | COC(CNc1nc[nH]c(=O)c1N)OC |
| InChI | InChI=1S/C8H14N4O3/c1-14-5(15-2)3-10-7-6(9)8(13)12-4-11-7/h4-5H,3,9H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | GLNZJLZQFPROLI-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|