C7H10N4O3 — CID 136973718
methyl 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]acetate (PubChem CID 136973718) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is methyl 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]acetate.
| Compound Name | methyl 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]acetate |
|---|---|
| PubChem CID | 136973718 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | methyl 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]acetate |
| SMILES | COC(=O)CNc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C7H10N4O3/c1-14-4(12)2-9-6-5(8)7(13)11-3-10-6/h3H,2,8H2,1H3,(H2,9,10,11,13) |
| InChIKey | PWYFGCCJYXZLSJ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |