C11H18N6O2 — CID 136974324
2-[4-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]piperidin-1-yl]acetamide (PubChem CID 136974324) has the molecular formula C11H18N6O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[4-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 136974324 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[4-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(Nc2nc[nH]c(=O)c2N)CC1 |
| InChI | InChI=1S/C11H18N6O2/c12-8(18)5-17-3-1-7(2-4-17)16-10-9(13)11(19)15-6-14-10/h6-7H,1-5,13H2,(H2,12,18)(H2,14,15,16,19) |
| InChIKey | UXLNSUQOHAUVOU-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |