C9H14N4O2 — CID 136974505
5-amino-4-(oxolan-3-ylmethylamino)-1H-pyrimidin-6-one (PubChem CID 136974505) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 5-amino-4-(oxolan-3-ylmethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(oxolan-3-ylmethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136974505 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 5-amino-4-(oxolan-3-ylmethylamino)-1H-pyrimidin-6-one |
| SMILES | Nc1c(NCC2CCOC2)nc[nH]c1=O |
| InChI | InChI=1S/C9H14N4O2/c10-7-8(12-5-13-9(7)14)11-3-6-1-2-15-4-6/h5-6H,1-4,10H2,(H2,11,12,13,14) |
| InChIKey | VZQNIJGUVCDCKC-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |