C11H20N4O2 — CID 136883388
5-amino-4-(4-propan-2-yloxybutylamino)-1H-pyrimidin-6-one (PubChem CID 136883388) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 5-amino-4-(4-propan-2-yloxybutylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(4-propan-2-yloxybutylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136883388 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 5-amino-4-(4-propan-2-yloxybutylamino)-1H-pyrimidin-6-one |
| SMILES | CC(C)OCCCCNc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C11H20N4O2/c1-8(2)17-6-4-3-5-13-10-9(12)11(16)15-7-14-10/h7-8H,3-6,12H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | XCXAGPSYFAHIGH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|