C10H16IN3O2 — CID 136975424
4-[3-(hydroxymethyl)pentan-3-ylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136975424) has the molecular formula C10H16IN3O2 and a molecular weight of 337.16 g/mol. Its IUPAC name is 4-[3-(hydroxymethyl)pentan-3-ylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[3-(hydroxymethyl)pentan-3-ylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136975424 |
| Molecular Formula | C10H16IN3O2 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 4-[3-(hydroxymethyl)pentan-3-ylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCC(CC)(CO)Nc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C10H16IN3O2/c1-3-10(4-2,5-15)14-8-7(11)9(16)13-6-12-8/h6,15H,3-5H2,1-2H3,(H2,12,13,14,16) |
| InChIKey | VNVOWVRXUVWXGK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|