C8H12IN3O4 — CID 136866840
4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136866840) has the molecular formula C8H12IN3O4 and a molecular weight of 341.11 g/mol. Its IUPAC name is 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136866840 |
| Molecular Formula | C8H12IN3O4 |
| Molecular Weight | 341.11 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NC(CO)(CO)CO)c1I |
| InChI | InChI=1S/C8H12IN3O4/c9-5-6(10-4-11-7(5)16)12-8(1-13,2-14)3-15/h4,13-15H,1-3H2,(H2,10,11,12,16) |
| InChIKey | MSTJTDZTNCOKDA-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.11 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|