C8H12IN3O3 — CID 136957038
4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136957038) has the molecular formula C8H12IN3O3 and a molecular weight of 325.11 g/mol. Its IUPAC name is 4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957038 |
| Molecular Formula | C8H12IN3O3 |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC(CO)(CO)Nc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C8H12IN3O3/c1-8(2-13,3-14)12-6-5(9)7(15)11-4-10-6/h4,13-14H,2-3H2,1H3,(H2,10,11,12,15) |
| InChIKey | HVUNEDLNBGUDMB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|