C9H12ClN3O3S — CID 136975783
5-chloro-4-[(1,1-dioxothian-3-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136975783) has the molecular formula C9H12ClN3O3S and a molecular weight of 277.73 g/mol. Its IUPAC name is 5-chloro-4-[(1,1-dioxothian-3-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[(1,1-dioxothian-3-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136975783 |
| Molecular Formula | C9H12ClN3O3S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 5-chloro-4-[(1,1-dioxothian-3-yl)amino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NC2CCCS(=O)(=O)C2)c1Cl |
| InChI | InChI=1S/C9H12ClN3O3S/c10-7-8(11-5-12-9(7)14)13-6-2-1-3-17(15,16)4-6/h5-6H,1-4H2,(H2,11,12,13,14) |
| InChIKey | CXAACCKNOFVJBA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |