C10H11ClN4O3 — CID 136976215
3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione (PubChem CID 136976215) has the molecular formula C10H11ClN4O3 and a molecular weight of 270.68 g/mol. Its IUPAC name is 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 136976215 |
| Molecular Formula | C10H11ClN4O3 |
| Molecular Weight | 270.68 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione |
| SMILES | CN1C(=O)CCC(Nc2nc[nH]c(=O)c2Cl)C1=O |
| InChI | InChI=1S/C10H11ClN4O3/c1-15-6(16)3-2-5(10(15)18)14-8-7(11)9(17)13-4-12-8/h4-5H,2-3H2,1H3,(H2,12,13,14,17) |
| InChIKey | KGJZDNCQROICGT-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.68 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|