C14H21N5O3 — CID 142367643
methane;3-(6-oxo-4-piperazin-1-ylpyrimidin-1-yl)piperidine-2,6-dione (PubChem CID 142367643) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is methane;3-(6-oxo-4-piperazin-1-ylpyrimidin-1-yl)piperidine-2,6-dione.
| Compound Name | methane;3-(6-oxo-4-piperazin-1-ylpyrimidin-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 142367643 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | methane;3-(6-oxo-4-piperazin-1-ylpyrimidin-1-yl)piperidine-2,6-dione |
| SMILES | C.O=C1CCC(n2cnc(N3CCNCC3)cc2=O)C(=O)N1 |
| InChI | InChI=1S/C13H17N5O3.CH4/c19-11-2-1-9(13(21)16-11)18-8-15-10(7-12(18)20)17-5-3-14-4-6-17;/h7-9,14H,1-6H2,(H,16,19,21);1H4 |
| InChIKey | QEEGPFIIMRZJEC-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|