C9H9N3O3 — CID 138467610
3-(6-oxopyrimidin-1-yl)piperidine-2,6-dione (PubChem CID 138467610) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-(6-oxopyrimidin-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-oxopyrimidin-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 138467610 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 3-(6-oxopyrimidin-1-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(n2cnccc2=O)C(=O)N1 |
| InChI | InChI=1S/C9H9N3O3/c13-7-2-1-6(9(15)11-7)12-5-10-4-3-8(12)14/h3-6H,1-2H2,(H,11,13,15) |
| InChIKey | KKIBXSVBZLWRSM-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|