C10H10BrN3O3 — CID 142364678
3-(4-bromo-2-methyl-6-oxopyrimidin-1-yl)piperidine-2,6-dione (PubChem CID 142364678) has the molecular formula C10H10BrN3O3 and a molecular weight of 300.11 g/mol. Its IUPAC name is 3-(4-bromo-2-methyl-6-oxopyrimidin-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-bromo-2-methyl-6-oxopyrimidin-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 142364678 |
| Molecular Formula | C10H10BrN3O3 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 3-(4-bromo-2-methyl-6-oxopyrimidin-1-yl)piperidine-2,6-dione |
| SMILES | Cc1nc(Br)cc(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H10BrN3O3/c1-5-12-7(11)4-9(16)14(5)6-2-3-8(15)13-10(6)17/h4,6H,2-3H2,1H3,(H,13,15,17) |
| InChIKey | DHHXRRYACZZBDV-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|