C9H11F2N3O — CID 136976578
2-cyclopropyl-4-(2,2-difluoroethylamino)-1H-pyrimidin-6-one (PubChem CID 136976578) has the molecular formula C9H11F2N3O and a molecular weight of 215.20 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,2-difluoroethylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-(2,2-difluoroethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976578 |
| Molecular Formula | C9H11F2N3O |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-cyclopropyl-4-(2,2-difluoroethylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCC(F)F)nc(C2CC2)[nH]1 |
| InChI | InChI=1S/C9H11F2N3O/c10-6(11)4-12-7-3-8(15)14-9(13-7)5-1-2-5/h3,5-6H,1-2,4H2,(H2,12,13,14,15) |
| InChIKey | KTMXDJQOFQOPIU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |