C9H10F3N3O — CID 136736697
2-methyl-4-[[1-(trifluoromethyl)cyclopropyl]amino]-1H-pyrimidin-6-one (PubChem CID 136736697) has the molecular formula C9H10F3N3O and a molecular weight of 233.19 g/mol. Its IUPAC name is 2-methyl-4-[[1-(trifluoromethyl)cyclopropyl]amino]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[[1-(trifluoromethyl)cyclopropyl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136736697 |
| Molecular Formula | C9H10F3N3O |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-methyl-4-[[1-(trifluoromethyl)cyclopropyl]amino]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(NC2(C(F)(F)F)CC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C9H10F3N3O/c1-5-13-6(4-7(16)14-5)15-8(2-3-8)9(10,11)12/h4H,2-3H2,1H3,(H2,13,14,15,16) |
| InChIKey | VADVUCKHCCMISV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |