C11H14F3N3O — CID 136976589
2-cyclopropyl-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one (PubChem CID 136976589) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 2-cyclopropyl-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976589 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-cyclopropyl-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCCCC(F)(F)F)nc(C2CC2)[nH]1 |
| InChI | InChI=1S/C11H14F3N3O/c12-11(13,14)4-1-5-15-8-6-9(18)17-10(16-8)7-2-3-7/h6-7H,1-5H2,(H2,15,16,17,18) |
| InChIKey | OJURPTRHFDMBMS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|