C10H17N3OS — CID 136977126
2-methyl-4-[(2-methyl-2-methylsulfanylpropyl)amino]-1H-pyrimidin-6-one (PubChem CID 136977126) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-methyl-4-[(2-methyl-2-methylsulfanylpropyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[(2-methyl-2-methylsulfanylpropyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136977126 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-methyl-4-[(2-methyl-2-methylsulfanylpropyl)amino]-1H-pyrimidin-6-one |
| SMILES | CSC(C)(C)CNc1cc(=O)[nH]c(C)n1 |
| InChI | InChI=1S/C10H17N3OS/c1-7-12-8(5-9(14)13-7)11-6-10(2,3)15-4/h5H,6H2,1-4H3,(H2,11,12,13,14) |
| InChIKey | LGGJOBMOXZEGDB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |