C12H17N3S — CID 114766642
2-methyl-6-[(2-methyl-2-methylsulfanylpropyl)amino]pyridine-4-carbonitrile (PubChem CID 114766642) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is 2-methyl-6-[(2-methyl-2-methylsulfanylpropyl)amino]pyridine-4-carbonitrile.
| Compound Name | 2-methyl-6-[(2-methyl-2-methylsulfanylpropyl)amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114766642 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-methyl-6-[(2-methyl-2-methylsulfanylpropyl)amino]pyridine-4-carbonitrile |
| SMILES | CSC(C)(C)CNc1cc(C#N)cc(C)n1 |
| InChI | InChI=1S/C12H17N3S/c1-9-5-10(7-13)6-11(15-9)14-8-12(2,3)16-4/h5-6H,8H2,1-4H3,(H,14,15) |
| InChIKey | UYSDJNDUOQNNOK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |