About 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile
2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile (PubChem CID 114765679) has the molecular formula C14H22N4
and a molecular weight of 246.36 g/mol. Its IUPAC name is 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile |
| PubChem CID | 114765679 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile |
| SMILES | Cc1cc(C#N)cc(NCC(C)(C)CN(C)C)n1 |
| InChI | InChI=1S/C14H22N4/c1-11-6-12(8-15)7-13(17-11)16-9-14(2,3)10-18(4)5/h6-7H,9-10H2,1-5H3,(H,16,17) |
| InChIKey | WDDPMTZGXSDEQP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile?
The IUPAC name of 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile (CID 114765679) is 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile.
What is the SMILES notation for 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile?
The canonical SMILES for 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile is Cc1cc(C#N)cc(NCC(C)(C)CN(C)C)n1.
What is the InChIKey of 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile?
The InChIKey is WDDPMTZGXSDEQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4/c1-11-6-12(8-15)7-13(17-11)16-9-14(2,3)10-18(4)5/h6-7H,9-10H2,1-5H3,(H,16,17).
What are the key properties of 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile?
2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile has a molecular weight of 246.36 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-6-methylpyridine-4-carbonitrile is sourced from PubChem (CID 114765679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).