C8H12ClN3O2S — CID 136977288
5-chloro-4-(2-ethylsulfinylethylamino)-1H-pyrimidin-6-one (PubChem CID 136977288) has the molecular formula C8H12ClN3O2S and a molecular weight of 249.72 g/mol. Its IUPAC name is 5-chloro-4-(2-ethylsulfinylethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2-ethylsulfinylethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136977288 |
| Molecular Formula | C8H12ClN3O2S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 5-chloro-4-(2-ethylsulfinylethylamino)-1H-pyrimidin-6-one |
| SMILES | CCS(=O)CCNc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H12ClN3O2S/c1-2-15(14)4-3-10-7-6(9)8(13)12-5-11-7/h5H,2-4H2,1H3,(H2,10,11,12,13) |
| InChIKey | RZRPVXPOLYHAKL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |