C12H18IN5O2 — CID 136978014
N-(2-aminoethyl)-1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperidine-3-carboxamide (PubChem CID 136978014) has the molecular formula C12H18IN5O2 and a molecular weight of 391.21 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 136978014 |
| Molecular Formula | C12H18IN5O2 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-(2-aminoethyl)-1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(c2nc[nH]c(=O)c2I)C1 |
| InChI | InChI=1S/C12H18IN5O2/c13-9-10(16-7-17-12(9)20)18-5-1-2-8(6-18)11(19)15-4-3-14/h7-8H,1-6,14H2,(H,15,19)(H,16,17,20) |
| InChIKey | YHQINHTXCFFHIR-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|