C12H17IN4O2 — CID 136957138
5-iodo-4-[(3-oxo-3-piperidin-1-ylpropyl)amino]-1H-pyrimidin-6-one (PubChem CID 136957138) has the molecular formula C12H17IN4O2 and a molecular weight of 376.20 g/mol. Its IUPAC name is 5-iodo-4-[(3-oxo-3-piperidin-1-ylpropyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[(3-oxo-3-piperidin-1-ylpropyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957138 |
| Molecular Formula | C12H17IN4O2 |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 5-iodo-4-[(3-oxo-3-piperidin-1-ylpropyl)amino]-1H-pyrimidin-6-one |
| SMILES | O=C(CCNc1nc[nH]c(=O)c1I)N1CCCCC1 |
| InChI | InChI=1S/C12H17IN4O2/c13-10-11(15-8-16-12(10)19)14-5-4-9(18)17-6-2-1-3-7-17/h8H,1-7H2,(H2,14,15,16,19) |
| InChIKey | QSBYLXPCXGOIAP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|