C12H17IN4O3 — CID 136956020
ethyl 4-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]piperidine-1-carboxylate (PubChem CID 136956020) has the molecular formula C12H17IN4O3 and a molecular weight of 392.20 g/mol. Its IUPAC name is ethyl 4-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 136956020 |
| Molecular Formula | C12H17IN4O3 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | ethyl 4-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2nc[nH]c(=O)c2I)CC1 |
| InChI | InChI=1S/C12H17IN4O3/c1-2-20-12(19)17-5-3-8(4-6-17)16-10-9(13)11(18)15-7-14-10/h7-8H,2-6H2,1H3,(H2,14,15,16,18) |
| InChIKey | WTBNBRGWJMKZDD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|