C11H15IN4O3 — CID 136689229
ethyl 4-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperazine-1-carboxylate (PubChem CID 136689229) has the molecular formula C11H15IN4O3 and a molecular weight of 378.17 g/mol. Its IUPAC name is ethyl 4-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 136689229 |
| Molecular Formula | C11H15IN4O3 |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | ethyl 4-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nc[nH]c(=O)c2I)CC1 |
| InChI | InChI=1S/C11H15IN4O3/c1-2-19-11(18)16-5-3-15(4-6-16)9-8(12)10(17)14-7-13-9/h7H,2-6H2,1H3,(H,13,14,17) |
| InChIKey | MCDFPFBPHXGIPY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|