C8H11IN4O — CID 136957743
5-iodo-4-piperazin-1-yl-1H-pyrimidin-6-one (PubChem CID 136957743) has the molecular formula C8H11IN4O and a molecular weight of 306.11 g/mol. Its IUPAC name is 5-iodo-4-piperazin-1-yl-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-piperazin-1-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957743 |
| Molecular Formula | C8H11IN4O |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 5-iodo-4-piperazin-1-yl-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CCNCC2)c1I |
| InChI | InChI=1S/C8H11IN4O/c9-6-7(11-5-12-8(6)14)13-3-1-10-2-4-13/h5,10H,1-4H2,(H,11,12,14) |
| InChIKey | AWMOPLLCZLGZSS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|