C11H17IN4OS — CID 137015987
4-[4-(aminomethyl)-4-methylsulfanylpiperidin-1-yl]-5-iodo-1H-pyrimidin-6-one (PubChem CID 137015987) has the molecular formula C11H17IN4OS and a molecular weight of 380.26 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-4-methylsulfanylpiperidin-1-yl]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[4-(aminomethyl)-4-methylsulfanylpiperidin-1-yl]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137015987 |
| Molecular Formula | C11H17IN4OS |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 4-[4-(aminomethyl)-4-methylsulfanylpiperidin-1-yl]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CSC1(CN)CCN(c2nc[nH]c(=O)c2I)CC1 |
| InChI | InChI=1S/C11H17IN4OS/c1-18-11(6-13)2-4-16(5-3-11)9-8(12)10(17)15-7-14-9/h7H,2-6,13H2,1H3,(H,14,15,17) |
| InChIKey | BTWKZRVXRHHQCW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|