C8H10IN3O2S — CID 136994013
5-iodo-4-(1-oxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one (PubChem CID 136994013) has the molecular formula C8H10IN3O2S and a molecular weight of 339.16 g/mol. Its IUPAC name is 5-iodo-4-(1-oxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(1-oxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136994013 |
| Molecular Formula | C8H10IN3O2S |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.95 |
| IUPAC Name | 5-iodo-4-(1-oxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CCS(=O)CC2)c1I |
| InChI | InChI=1S/C8H10IN3O2S/c9-6-7(10-5-11-8(6)13)12-1-3-15(14)4-2-12/h5H,1-4H2,(H,10,11,13) |
| InChIKey | IEPKOXNDLFBBRD-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|