C18H20N6S — CID 136980301
3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-4-yl]-4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 136980301) has the molecular formula C18H20N6S and a molecular weight of 352.47 g/mol. Its IUPAC name is 3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-4-yl]-4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-4-yl]-4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 136980301 |
| Molecular Formula | C18H20N6S |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-[1-[(5-methylthiophen-2-yl)methyl]piperidin-4-yl]-4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1ccc(CN2CCC(c3nnn4cnc5[nH]ccc5c34)CC2)s1 |
| InChI | InChI=1S/C18H20N6S/c1-12-2-3-14(25-12)10-23-8-5-13(6-9-23)16-17-15-4-7-19-18(15)20-11-24(17)22-21-16/h2-4,7,11,13,19H,5-6,8-10H2,1H3 |
| InChIKey | PIWAXKZODUGJFH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |