C7H7IN2O — CID 136981066
2-iodo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one (PubChem CID 136981066) has the molecular formula C7H7IN2O and a molecular weight of 262.05 g/mol. Its IUPAC name is 2-iodo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one.
| Compound Name | 2-iodo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136981066 |
| Molecular Formula | C7H7IN2O |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 2-iodo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(I)nc2c1CCC2 |
| InChI | InChI=1S/C7H7IN2O/c8-7-9-5-3-1-2-4(5)6(11)10-7/h1-3H2,(H,9,10,11) |
| InChIKey | GGOLURXIVNLPNN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|