C13H13N3O2 — CID 136982295
4-(4-amino-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)phenol (PubChem CID 136982295) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 4-(4-amino-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)phenol.
| Compound Name | 4-(4-amino-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)phenol |
|---|---|
| PubChem CID | 136982295 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 4-(4-amino-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)phenol |
| SMILES | Nc1nc(-c2ccc(O)cc2)nc2c1COCC2 |
| InChI | InChI=1S/C13H13N3O2/c14-12-10-7-18-6-5-11(10)15-13(16-12)8-1-3-9(17)4-2-8/h1-4,17H,5-7H2,(H2,14,15,16) |
| InChIKey | PLLSGBZNWQSYDX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |