C15H19N3O2 — CID 136984258
2-[[(4-methyloxan-4-yl)amino]methyl]-3H-quinazolin-4-one (PubChem CID 136984258) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-[[(4-methyloxan-4-yl)amino]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[(4-methyloxan-4-yl)amino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136984258 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-[[(4-methyloxan-4-yl)amino]methyl]-3H-quinazolin-4-one |
| SMILES | CC1(NCc2nc3ccccc3c(=O)[nH]2)CCOCC1 |
| InChI | InChI=1S/C15H19N3O2/c1-15(6-8-20-9-7-15)16-10-13-17-12-5-3-2-4-11(12)14(19)18-13/h2-5,16H,6-10H2,1H3,(H,17,18,19) |
| InChIKey | XSYLMQQMMFOHPN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |