About 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine
3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine (PubChem CID 136984377) has the molecular formula C10H8N6O
and a molecular weight of 228.22 g/mol. Its IUPAC name is 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine |
| PubChem CID | 136984377 |
| Molecular Formula | C10H8N6O |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine |
| SMILES | Nc1nccnc1-c1nc(-c2ccc[nH]2)no1 |
| InChI | InChI=1S/C10H8N6O/c11-8-7(13-4-5-14-8)10-15-9(16-17-10)6-2-1-3-12-6/h1-5,12H,(H2,11,14) |
| InChIKey | XYSFSJVMHYNYRT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine?
The IUPAC name of 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine (CID 136984377) is 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine.
What is the SMILES notation for 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine?
The canonical SMILES for 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine is Nc1nccnc1-c1nc(-c2ccc[nH]2)no1.
What is the InChIKey of 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine?
The InChIKey is XYSFSJVMHYNYRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N6O/c11-8-7(13-4-5-14-8)10-15-9(16-17-10)6-2-1-3-12-6/h1-5,12H,(H2,11,14).
What are the key properties of 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine?
3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine has a molecular weight of 228.22 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]pyrazin-2-amine is sourced from PubChem (CID 136984377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).