C11H8N6O — CID 63260210
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)pyrazin-2-amine (PubChem CID 63260210) has the molecular formula C11H8N6O and a molecular weight of 240.23 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)pyrazin-2-amine.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 63260210 |
| Molecular Formula | C11H8N6O |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)pyrazin-2-amine |
| SMILES | Nc1nccnc1-c1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C11H8N6O/c12-9-8(14-4-5-15-9)11-16-10(17-18-11)7-2-1-3-13-6-7/h1-6H,(H2,12,15) |
| InChIKey | OVOMYROVBCBIRM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |