C7H7N5O — CID 47003158
(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)hydrazine (PubChem CID 47003158) has the molecular formula C7H7N5O and a molecular weight of 177.17 g/mol. Its IUPAC name is (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)hydrazine.
| Compound Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)hydrazine |
|---|---|
| PubChem CID | 47003158 |
| Molecular Formula | C7H7N5O |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)hydrazine |
| SMILES | NNc1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C7H7N5O/c8-11-7-10-6(12-13-7)5-2-1-3-9-4-5/h1-4H,8H2,(H,10,11,12) |
| InChIKey | OGEXCNFKRLCBJO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|