C12H12N4O — CID 136985765
2-(3-amino-1-methylpyrazol-5-yl)-1H-indol-6-ol (PubChem CID 136985765) has the molecular formula C12H12N4O and a molecular weight of 228.26 g/mol. Its IUPAC name is 2-(3-amino-1-methylpyrazol-5-yl)-1H-indol-6-ol.
| Compound Name | 2-(3-amino-1-methylpyrazol-5-yl)-1H-indol-6-ol |
|---|---|
| PubChem CID | 136985765 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(3-amino-1-methylpyrazol-5-yl)-1H-indol-6-ol |
| SMILES | Cn1nc(N)cc1-c1cc2ccc(O)cc2[nH]1 |
| InChI | InChI=1S/C12H12N4O/c1-16-11(6-12(13)15-16)10-4-7-2-3-8(17)5-9(7)14-10/h2-6,14,17H,1H3,(H2,13,15) |
| InChIKey | OBABEUQXNWFRTM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |