C13H11F3N4 — CID 136985773
1-methyl-5-[5-(trifluoromethyl)-1H-indol-2-yl]pyrazol-3-amine (PubChem CID 136985773) has the molecular formula C13H11F3N4 and a molecular weight of 280.25 g/mol. Its IUPAC name is 1-methyl-5-[5-(trifluoromethyl)-1H-indol-2-yl]pyrazol-3-amine.
| Compound Name | 1-methyl-5-[5-(trifluoromethyl)-1H-indol-2-yl]pyrazol-3-amine |
|---|---|
| PubChem CID | 136985773 |
| Molecular Formula | C13H11F3N4 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-methyl-5-[5-(trifluoromethyl)-1H-indol-2-yl]pyrazol-3-amine |
| SMILES | Cn1nc(N)cc1-c1cc2cc(C(F)(F)F)ccc2[nH]1 |
| InChI | InChI=1S/C13H11F3N4/c1-20-11(6-12(17)19-20)10-5-7-4-8(13(14,15)16)2-3-9(7)18-10/h2-6,18H,1H3,(H2,17,19) |
| InChIKey | MULGHLYICZBKTQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |