C13H11N3O3 — CID 136986478
5-(5-methoxy-1H-indol-2-yl)-1H-pyrazole-4-carboxylic acid (PubChem CID 136986478) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 5-(5-methoxy-1H-indol-2-yl)-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-(5-methoxy-1H-indol-2-yl)-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 136986478 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 5-(5-methoxy-1H-indol-2-yl)-1H-pyrazole-4-carboxylic acid |
| SMILES | COc1ccc2[nH]c(-c3[nH]ncc3C(=O)O)cc2c1 |
| InChI | InChI=1S/C13H11N3O3/c1-19-8-2-3-10-7(4-8)5-11(15-10)12-9(13(17)18)6-14-16-12/h2-6,15H,1H3,(H,14,16)(H,17,18) |
| InChIKey | SLYUDPQEKXXLMS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |