C12H15N3S — CID 136988563
4-methyl-5-pyrrolidin-3-yl-2-(1H-pyrrol-2-yl)-1,3-thiazole (PubChem CID 136988563) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 4-methyl-5-pyrrolidin-3-yl-2-(1H-pyrrol-2-yl)-1,3-thiazole.
| Compound Name | 4-methyl-5-pyrrolidin-3-yl-2-(1H-pyrrol-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 136988563 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 4-methyl-5-pyrrolidin-3-yl-2-(1H-pyrrol-2-yl)-1,3-thiazole |
| SMILES | Cc1nc(-c2ccc[nH]2)sc1C1CCNC1 |
| InChI | InChI=1S/C12H15N3S/c1-8-11(9-4-6-13-7-9)16-12(15-8)10-3-2-5-14-10/h2-3,5,9,13-14H,4,6-7H2,1H3 |
| InChIKey | IKQAKHOWRJUMRA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |