C12H14N2S — CID 79146802
4-methyl-2-pyrrolidin-3-yl-1,3-benzothiazole (PubChem CID 79146802) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 4-methyl-2-pyrrolidin-3-yl-1,3-benzothiazole.
| Compound Name | 4-methyl-2-pyrrolidin-3-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 79146802 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-methyl-2-pyrrolidin-3-yl-1,3-benzothiazole |
| SMILES | Cc1cccc2sc(C3CCNC3)nc12 |
| InChI | InChI=1S/C12H14N2S/c1-8-3-2-4-10-11(8)14-12(15-10)9-5-6-13-7-9/h2-4,9,13H,5-7H2,1H3 |
| InChIKey | SIRDXMCJXXGVJM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |