C17H14ClFN2O2 — CID 1369889
N-[2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-yl]butanamide (PubChem CID 1369889) has the molecular formula C17H14ClFN2O2 and a molecular weight of 332.76 g/mol. Its IUPAC name is N-[2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-yl]butanamide.
| Compound Name | N-[2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-yl]butanamide |
|---|---|
| PubChem CID | 1369889 |
| Molecular Formula | C17H14ClFN2O2 |
| Molecular Weight | 332.76 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-[2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2oc(-c3ccc(F)cc3Cl)nc2c1 |
| InChI | InChI=1S/C17H14ClFN2O2/c1-2-3-16(22)20-11-5-7-15-14(9-11)21-17(23-15)12-6-4-10(19)8-13(12)18/h4-9H,2-3H2,1H3,(H,20,22) |
| InChIKey | AWTIOGPIZFXRJE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.76 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |