C12H19N3O4 — CID 136989663
methyl 2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]-2-methylpentanoate (PubChem CID 136989663) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]-2-methylpentanoate.
| Compound Name | methyl 2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]-2-methylpentanoate |
|---|---|
| PubChem CID | 136989663 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl 2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]-2-methylpentanoate |
| SMILES | CCCC(C)(Nc1nc[nH]c(=O)c1OC)C(=O)OC |
| InChI | InChI=1S/C12H19N3O4/c1-5-6-12(2,11(17)19-4)15-9-8(18-3)10(16)14-7-13-9/h7H,5-6H2,1-4H3,(H2,13,14,15,16) |
| InChIKey | DZHVVJSYSCTMPO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |