C11H19BrN4O — CID 136989726
5-bromo-4-[2-(tert-butylamino)ethyl-methylamino]-1H-pyrimidin-6-one (PubChem CID 136989726) has the molecular formula C11H19BrN4O and a molecular weight of 303.20 g/mol. Its IUPAC name is 5-bromo-4-[2-(tert-butylamino)ethyl-methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[2-(tert-butylamino)ethyl-methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136989726 |
| Molecular Formula | C11H19BrN4O |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 5-bromo-4-[2-(tert-butylamino)ethyl-methylamino]-1H-pyrimidin-6-one |
| SMILES | CN(CCNC(C)(C)C)c1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C11H19BrN4O/c1-11(2,3)15-5-6-16(4)9-8(12)10(17)14-7-13-9/h7,15H,5-6H2,1-4H3,(H,13,14,17) |
| InChIKey | ZRZIZAULCFAVCQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |