C11H8ClFN2O3 — CID 136992118
5-(3-chloro-5-fluoro-2-hydroxyphenyl)-1-methylpyrazole-3-carboxylic acid (PubChem CID 136992118) has the molecular formula C11H8ClFN2O3 and a molecular weight of 270.65 g/mol. Its IUPAC name is 5-(3-chloro-5-fluoro-2-hydroxyphenyl)-1-methylpyrazole-3-carboxylic acid.
| Compound Name | 5-(3-chloro-5-fluoro-2-hydroxyphenyl)-1-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 136992118 |
| Molecular Formula | C11H8ClFN2O3 |
| Molecular Weight | 270.65 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 5-(3-chloro-5-fluoro-2-hydroxyphenyl)-1-methylpyrazole-3-carboxylic acid |
| SMILES | Cn1nc(C(=O)O)cc1-c1cc(F)cc(Cl)c1O |
| InChI | InChI=1S/C11H8ClFN2O3/c1-15-9(4-8(14-15)11(17)18)6-2-5(13)3-7(12)10(6)16/h2-4,16H,1H3,(H,17,18) |
| InChIKey | CKJKMEXHUJRLFP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |