C14H15ClN2O3 — CID 137003429
5-(3-chloro-2-hydroxy-5-propan-2-ylphenyl)-1-methylpyrazole-3-carboxylic acid (PubChem CID 137003429) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 5-(3-chloro-2-hydroxy-5-propan-2-ylphenyl)-1-methylpyrazole-3-carboxylic acid.
| Compound Name | 5-(3-chloro-2-hydroxy-5-propan-2-ylphenyl)-1-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 137003429 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 5-(3-chloro-2-hydroxy-5-propan-2-ylphenyl)-1-methylpyrazole-3-carboxylic acid |
| SMILES | CC(C)c1cc(Cl)c(O)c(-c2cc(C(=O)O)nn2C)c1 |
| InChI | InChI=1S/C14H15ClN2O3/c1-7(2)8-4-9(13(18)10(15)5-8)12-6-11(14(19)20)16-17(12)3/h4-7,18H,1-3H3,(H,19,20) |
| InChIKey | PIBHBPHWDYDEIT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |