C15H9BrN2O6 — CID 136992655
2-[(5-bromo-2-oxo-1H-indol-3-ylidene)amino]-3,4,5-trihydroxybenzoic acid (PubChem CID 136992655) has the molecular formula C15H9BrN2O6 and a molecular weight of 393.15 g/mol. Its IUPAC name is 2-[(5-bromo-2-oxo-1H-indol-3-ylidene)amino]-3,4,5-trihydroxybenzoic acid.
| Compound Name | 2-[(5-bromo-2-oxo-1H-indol-3-ylidene)amino]-3,4,5-trihydroxybenzoic acid |
|---|---|
| PubChem CID | 136992655 |
| Molecular Formula | C15H9BrN2O6 |
| Molecular Weight | 393.15 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 2-[(5-bromo-2-oxo-1H-indol-3-ylidene)amino]-3,4,5-trihydroxybenzoic acid |
| SMILES | O=C1Nc2ccc(Br)cc2/C1=N\c1c(C(=O)O)cc(O)c(O)c1O |
| InChI | InChI=1S/C15H9BrN2O6/c16-5-1-2-8-6(3-5)11(14(22)17-8)18-10-7(15(23)24)4-9(19)12(20)13(10)21/h1-4,19-21H,(H,23,24)(H,17,18,22) |
| InChIKey | XZHRFFOGUKGQGZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 139.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.15 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|