C17H16F4N4O — CID 136992950
(4S,6S)-4-(2-fluoro-5-pyrimidin-5-ylphenyl)-N,4-dimethyl-6-(trifluoromethyl)-1,3-oxazinan-2-imine (PubChem CID 136992950) has the molecular formula C17H16F4N4O and a molecular weight of 368.33 g/mol. Its IUPAC name is (4S,6S)-4-(2-fluoro-5-pyrimidin-5-ylphenyl)-N,4-dimethyl-6-(trifluoromethyl)-1,3-oxazinan-2-imine.
| Compound Name | (4S,6S)-4-(2-fluoro-5-pyrimidin-5-ylphenyl)-N,4-dimethyl-6-(trifluoromethyl)-1,3-oxazinan-2-imine |
|---|---|
| PubChem CID | 136992950 |
| Molecular Formula | C17H16F4N4O |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (4S,6S)-4-(2-fluoro-5-pyrimidin-5-ylphenyl)-N,4-dimethyl-6-(trifluoromethyl)-1,3-oxazinan-2-imine |
| SMILES | C/N=C1/N[C@](C)(c2cc(-c3cncnc3)ccc2F)C[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C17H16F4N4O/c1-16(6-14(17(19,20)21)26-15(22-2)25-16)12-5-10(3-4-13(12)18)11-7-23-9-24-8-11/h3-5,7-9,14H,6H2,1-2H3,(H,22,25)/t14-,16-/m0/s1 |
| InChIKey | YBVWTPMRJLQBMS-HOCLYGCPSA-N |
| XLogP | 3.42 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|