C19H25FN4O — CID 75513885
N-[3-(1-benzylpiperidin-4-yl)oxypropyl]-5-fluoropyrimidin-2-amine (PubChem CID 75513885) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is N-[3-(1-benzylpiperidin-4-yl)oxypropyl]-5-fluoropyrimidin-2-amine.
| Compound Name | N-[3-(1-benzylpiperidin-4-yl)oxypropyl]-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 75513885 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N-[3-(1-benzylpiperidin-4-yl)oxypropyl]-5-fluoropyrimidin-2-amine |
| SMILES | Fc1cnc(NCCCOC2CCN(Cc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C19H25FN4O/c20-17-13-22-19(23-14-17)21-9-4-12-25-18-7-10-24(11-8-18)15-16-5-2-1-3-6-16/h1-3,5-6,13-14,18H,4,7-12,15H2,(H,21,22,23) |
| InChIKey | JZLOHKWFVHWUNQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|