C13H13FN2O2S — CID 136993028
5-[(E)-C-ethyl-N-methoxycarbonimidoyl]-2-(3-fluorophenyl)-1,3-thiazol-4-ol (PubChem CID 136993028) has the molecular formula C13H13FN2O2S and a molecular weight of 280.32 g/mol. Its IUPAC name is 5-[(E)-C-ethyl-N-methoxycarbonimidoyl]-2-(3-fluorophenyl)-1,3-thiazol-4-ol.
| Compound Name | 5-[(E)-C-ethyl-N-methoxycarbonimidoyl]-2-(3-fluorophenyl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 136993028 |
| Molecular Formula | C13H13FN2O2S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 5-[(E)-C-ethyl-N-methoxycarbonimidoyl]-2-(3-fluorophenyl)-1,3-thiazol-4-ol |
| SMILES | CC/C(=N\OC)c1sc(-c2cccc(F)c2)nc1O |
| InChI | InChI=1S/C13H13FN2O2S/c1-3-10(16-18-2)11-12(17)15-13(19-11)8-5-4-6-9(14)7-8/h4-7,17H,3H2,1-2H3/b16-10+ |
| InChIKey | NVNPCVDKVNSKAX-MHWRWJLKSA-N |
| XLogP | 3.42 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|