C12H10FN5OS — CID 171358627
5-(1-ethyltetrazol-5-yl)-2-(3-fluorophenyl)-1,3-thiazol-4-ol (PubChem CID 171358627) has the molecular formula C12H10FN5OS and a molecular weight of 291.31 g/mol. Its IUPAC name is 5-(1-ethyltetrazol-5-yl)-2-(3-fluorophenyl)-1,3-thiazol-4-ol.
| Compound Name | 5-(1-ethyltetrazol-5-yl)-2-(3-fluorophenyl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 171358627 |
| Molecular Formula | C12H10FN5OS |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 5-(1-ethyltetrazol-5-yl)-2-(3-fluorophenyl)-1,3-thiazol-4-ol |
| SMILES | CCn1nnnc1-c1sc(-c2cccc(F)c2)nc1O |
| InChI | InChI=1S/C12H10FN5OS/c1-2-18-10(15-16-17-18)9-11(19)14-12(20-9)7-4-3-5-8(13)6-7/h3-6,19H,2H2,1H3 |
| InChIKey | DOPCYQFKFWRLQZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |